C12H10N2O3 — CID 21234538
(E)-2-cyano-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 21234538) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21234538 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (E)-2-cyano-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | Cc1cc2c(cc1/C=C(\C#N)C(N)=O)OCO2 |
| InChI | InChI=1S/C12H10N2O3/c1-7-2-10-11(17-6-16-10)4-8(7)3-9(5-13)12(14)15/h2-4H,6H2,1H3,(H2,14,15)/b9-3+ |
| InChIKey | MVLQPDTXZOUBHI-YCRREMRBSA-N |
| XLogP | 1.12 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|