C15H12N4O3 — CID 10565850
(E)-3-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-2-cyanoprop-2-enamide (PubChem CID 10565850) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is (E)-3-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 10565850 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (E)-3-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-2-cyanoprop-2-enamide |
| SMILES | Cn1c(-c2ccc3c(c2)OCO3)cnc1/C=C(\C#N)C(N)=O |
| InChI | InChI=1S/C15H12N4O3/c1-19-11(7-18-14(19)5-10(6-16)15(17)20)9-2-3-12-13(4-9)22-8-21-12/h2-5,7H,8H2,1H3,(H2,17,20)/b10-5+ |
| InChIKey | LOJJCDXPVXNPLX-BJMVGYQFSA-N |
| XLogP | 1.21 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|