C26H28N2O7 — CID 21242872
5-phenylpentyl (5Z)-5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate (PubChem CID 21242872) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 5-phenylpentyl (5Z)-5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 5-phenylpentyl (5Z)-5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 21242872 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 5-phenylpentyl (5Z)-5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate |
| SMILES | CO/C(O)=C1\C(=O)NC(C)=C(C(=O)OCCCCCc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28N2O7/c1-17-21(26(31)35-15-8-4-7-12-18-10-5-3-6-11-18)22(23(24(29)27-17)25(30)34-2)19-13-9-14-20(16-19)28(32)33/h3,5-6,9-11,13-14,16,22,30H,4,7-8,12,15H2,1-2H3,(H,27,29)/b25-23- |
| InChIKey | APYQDFNPPGMHSG-BZZOAKBMSA-N |
| XLogP | 4.45 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|