C23H27N3O7 — CID 70042182
1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl 5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate (PubChem CID 70042182) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl 5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl 5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70042182 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl 5-[hydroxy(methoxy)methylidene]-2-methyl-4-(3-nitrophenyl)-6-oxo-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(O)=C1C(=O)NC(C)=C(C(=O)OCC23CCCN2CCC3)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N3O7/c1-14-17(22(29)33-13-23-8-4-10-25(23)11-5-9-23)18(19(20(27)24-14)21(28)32-2)15-6-3-7-16(12-15)26(30)31/h3,6-7,12,18,28H,4-5,8-11,13H2,1-2H3,(H,24,27) |
| InChIKey | NLYFGSHHLXLBBN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|