C20H19ClN6O2S — CID 2124685
3-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 2124685) has the molecular formula C20H19ClN6O2S and a molecular weight of 442.93 g/mol. Its IUPAC name is 3-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 2124685 |
| Molecular Formula | C20H19ClN6O2S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | COCCCn1c(SCn2nnc3ccccc3c2=O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN6O2S/c1-29-12-4-11-26-18(14-7-9-15(21)10-8-14)23-24-20(26)30-13-27-19(28)16-5-2-3-6-17(16)22-25-27/h2-3,5-10H,4,11-13H2,1H3 |
| InChIKey | YXQJFJHICXHCHM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|