C38H41N3O6S — CID 21254046
2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butyl-phenylmethoxycarbonylamino]ethyl]-1H-indole-5-carboxylic acid (PubChem CID 21254046) has the molecular formula C38H41N3O6S and a molecular weight of 667.83 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butyl-phenylmethoxycarbonylamino]ethyl]-1H-indole-5-carboxylic acid.
| Compound Name | 2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butyl-phenylmethoxycarbonylamino]ethyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 21254046 |
| Molecular Formula | C38H41N3O6S |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butyl-phenylmethoxycarbonylamino]ethyl]-1H-indole-5-carboxylic acid |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccc(C(=O)O)cc3c2CCN(CCCCc2ccc(NS(C)(=O)=O)cc2)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C38H41N3O6S/c1-26-21-27(2)23-31(22-26)36-33(34-24-30(37(42)43)14-17-35(34)39-36)18-20-41(38(44)47-25-29-10-5-4-6-11-29)19-8-7-9-28-12-15-32(16-13-28)40-48(3,45)46/h4-6,10-17,21-24,39-40H,7-9,18-20,25H2,1-3H3,(H,42,43) |
| InChIKey | SNNOGTYHXPPIFE-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|