About dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride
dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride (PubChem CID 21258677) has the molecular formula C26H58Al2
and a molecular weight of 424.71 g/mol. Its IUPAC name is dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride.
Molecular Properties
| Compound Name | dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride |
| PubChem CID | 21258677 |
| Molecular Formula | C26H58Al2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.42 |
| IUPAC Name | dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride |
| SMILES | CCCCCC[Al+]CCCCCC.CCCCCC[Al](CC(C)C)CC(C)C.[H-] |
| InChI | InChI=1S/3C6H13.2C4H9.2Al.H/c3*1-3-5-6-4-2;2*1-4(2)3;;;/h3*1,3-6H2,2H3;2*4H,1H2,2-3H3;;;/q;;;;;;+1;-1 |
| InChIKey | JXZWKRRICFODCY-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride?
The IUPAC name of dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride (CID 21258677) is dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride.
What is the SMILES notation for dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride?
The canonical SMILES for dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride is CCCCCC[Al+]CCCCCC.CCCCCC[Al](CC(C)C)CC(C)C.[H-].
What is the InChIKey of dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride?
The InChIKey is JXZWKRRICFODCY-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H13.2C4H9.2Al.H/c3*1-3-5-6-4-2;2*1-4(2)3;;;/h3*1,3-6H2,2H3;2*4H,1H2,2-3H3;;;/q;;;;;;+1;-1.
What are the key properties of dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride?
dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride has a molecular weight of 424.71 g/mol, XLogP of 10.17, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dihexylalumanylium;hexyl-bis(2-methylpropyl)alumane;hydride is sourced from PubChem (CID 21258677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).