C27H31N3O7S — CID 21270486
5-[3-[2-(benzenesulfinyl)ethyl-methylamino]propoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 21270486) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is 5-[3-[2-(benzenesulfinyl)ethyl-methylamino]propoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[3-[2-(benzenesulfinyl)ethyl-methylamino]propoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 21270486 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 5-[3-[2-(benzenesulfinyl)ethyl-methylamino]propoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCCN(C)CCS(=O)c2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C27H31N3O7S/c1-18-23(26(31)32)25(20-9-7-10-21(17-20)30(34)35)24(19(2)28-18)27(33)37-15-8-13-29(3)14-16-38(36)22-11-5-4-6-12-22/h4-7,9-12,17,25,28H,8,13-16H2,1-3H3,(H,31,32) |
| InChIKey | QLGPSALUTGGRCQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|