C18H25N3OS — CID 21278608
1-(2-aminophenyl)-2,2-dimethylpropan-1-one;5-ethyl-6-methyl-1H-pyrimidine-2-thione (PubChem CID 21278608) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2,2-dimethylpropan-1-one;5-ethyl-6-methyl-1H-pyrimidine-2-thione.
| Compound Name | 1-(2-aminophenyl)-2,2-dimethylpropan-1-one;5-ethyl-6-methyl-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 21278608 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(2-aminophenyl)-2,2-dimethylpropan-1-one;5-ethyl-6-methyl-1H-pyrimidine-2-thione |
| SMILES | CC(C)(C)C(=O)c1ccccc1N.CCc1cnc(=S)[nH]c1C |
| InChI | InChI=1S/C11H15NO.C7H10N2S/c1-11(2,3)10(13)8-6-4-5-7-9(8)12;1-3-6-4-8-7(10)9-5(6)2/h4-7H,12H2,1-3H3;4H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | YXYXEKJMALZKIM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|