C24H15Cl2NO3 — CID 21280823
2-[2-(3,6-dichloroanthracen-9-yl)oxyethyl]isoindole-1,3-dione (PubChem CID 21280823) has the molecular formula C24H15Cl2NO3 and a molecular weight of 436.29 g/mol. Its IUPAC name is 2-[2-(3,6-dichloroanthracen-9-yl)oxyethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3,6-dichloroanthracen-9-yl)oxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21280823 |
| Molecular Formula | C24H15Cl2NO3 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-[2-(3,6-dichloroanthracen-9-yl)oxyethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOc1c2ccc(Cl)cc2cc2cc(Cl)ccc12 |
| InChI | InChI=1S/C24H15Cl2NO3/c25-16-5-7-18-14(12-16)11-15-13-17(26)6-8-19(15)22(18)30-10-9-27-23(28)20-3-1-2-4-21(20)24(27)29/h1-8,11-13H,9-10H2 |
| InChIKey | STRGGQUKQGWWDD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|