C7H13NO9P2 — CID 21284775
[1-hydroxy-3-(3-methoxy-1,2-oxazol-5-yl)-1-phosphonopropyl]phosphonic acid (PubChem CID 21284775) has the molecular formula C7H13NO9P2 and a molecular weight of 317.13 g/mol. Its IUPAC name is [1-hydroxy-3-(3-methoxy-1,2-oxazol-5-yl)-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-3-(3-methoxy-1,2-oxazol-5-yl)-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 21284775 |
| Molecular Formula | C7H13NO9P2 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [1-hydroxy-3-(3-methoxy-1,2-oxazol-5-yl)-1-phosphonopropyl]phosphonic acid |
| SMILES | COc1cc(CCC(O)(P(=O)(O)O)P(=O)(O)O)on1 |
| InChI | InChI=1S/C7H13NO9P2/c1-16-6-4-5(17-8-6)2-3-7(9,18(10,11)12)19(13,14)15/h4,9H,2-3H2,1H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | KFSCOTLDXYOCDF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|