C5H5NO5 — CID 66616886
(3-methoxy-1,2-oxazol-5-yl) hydrogen carbonate (PubChem CID 66616886) has the molecular formula C5H5NO5 and a molecular weight of 159.10 g/mol. Its IUPAC name is (3-methoxy-1,2-oxazol-5-yl) hydrogen carbonate.
| Compound Name | (3-methoxy-1,2-oxazol-5-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 66616886 |
| Molecular Formula | C5H5NO5 |
| Molecular Weight | 159.10 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | (3-methoxy-1,2-oxazol-5-yl) hydrogen carbonate |
| SMILES | COc1cc(OC(=O)O)on1 |
| InChI | InChI=1S/C5H5NO5/c1-9-3-2-4(11-6-3)10-5(7)8/h2H,1H3,(H,7,8) |
| InChIKey | OZPLVSFUCHPEOW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |