C5H6ClNO3 — CID 130283751
chloro-(3-methoxy-1,2-oxazol-5-yl)methanol (PubChem CID 130283751) has the molecular formula C5H6ClNO3 and a molecular weight of 163.56 g/mol. Its IUPAC name is chloro-(3-methoxy-1,2-oxazol-5-yl)methanol.
| Compound Name | chloro-(3-methoxy-1,2-oxazol-5-yl)methanol |
|---|---|
| PubChem CID | 130283751 |
| Molecular Formula | C5H6ClNO3 |
| Molecular Weight | 163.56 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | chloro-(3-methoxy-1,2-oxazol-5-yl)methanol |
| SMILES | COc1cc(C(O)Cl)on1 |
| InChI | InChI=1S/C5H6ClNO3/c1-9-4-2-3(5(6)8)10-7-4/h2,5,8H,1H3 |
| InChIKey | OHXXMDUCDZQHFD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|