C7H8N2O2 — CID 138470279
2-(3-methoxy-1,2-oxazol-5-yl)propanenitrile (PubChem CID 138470279) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-(3-methoxy-1,2-oxazol-5-yl)propanenitrile.
| Compound Name | 2-(3-methoxy-1,2-oxazol-5-yl)propanenitrile |
|---|---|
| PubChem CID | 138470279 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-(3-methoxy-1,2-oxazol-5-yl)propanenitrile |
| SMILES | COc1cc(C(C)C#N)on1 |
| InChI | InChI=1S/C7H8N2O2/c1-5(4-8)6-3-7(10-2)9-11-6/h3,5H,1-2H3 |
| InChIKey | GCFVSZFHRYWJOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |