C7H9NO4 — CID 118467299
(3-propyl-1,2-oxazol-5-yl) hydrogen carbonate (PubChem CID 118467299) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (3-propyl-1,2-oxazol-5-yl) hydrogen carbonate.
| Compound Name | (3-propyl-1,2-oxazol-5-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 118467299 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (3-propyl-1,2-oxazol-5-yl) hydrogen carbonate |
| SMILES | CCCc1cc(OC(=O)O)on1 |
| InChI | InChI=1S/C7H9NO4/c1-2-3-5-4-6(12-8-5)11-7(9)10/h4H,2-3H2,1H3,(H,9,10) |
| InChIKey | XCSZCYCHHXHILQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |