C11H7F4N2O5- — CID 21285539
2-[(5-fluoro-2-nitrophenyl)methyl-(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 21285539) has the molecular formula C11H7F4N2O5- and a molecular weight of 323.18 g/mol. Its IUPAC name is 2-[(5-fluoro-2-nitrophenyl)methyl-(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | 2-[(5-fluoro-2-nitrophenyl)methyl-(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 21285539 |
| Molecular Formula | C11H7F4N2O5- |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[(5-fluoro-2-nitrophenyl)methyl-(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | O=C([O-])CN(Cc1cc(F)ccc1[N+](=O)[O-])C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H8F4N2O5/c12-7-1-2-8(17(21)22)6(3-7)4-16(5-9(18)19)10(20)11(13,14)15/h1-3H,4-5H2,(H,18,19)/p-1 |
| InChIKey | SDNNXZFAXCYFEF-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|