C25H23NO3 — CID 21287380
5-[3-(methylamino)-1-phenylpropoxy]-3-phenylchromen-4-one (PubChem CID 21287380) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-[3-(methylamino)-1-phenylpropoxy]-3-phenylchromen-4-one.
| Compound Name | 5-[3-(methylamino)-1-phenylpropoxy]-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 21287380 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-[3-(methylamino)-1-phenylpropoxy]-3-phenylchromen-4-one |
| SMILES | CNCCC(Oc1cccc2occ(-c3ccccc3)c(=O)c12)c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-26-16-15-21(19-11-6-3-7-12-19)29-23-14-8-13-22-24(23)25(27)20(17-28-22)18-9-4-2-5-10-18/h2-14,17,21,26H,15-16H2,1H3 |
| InChIKey | QXZDYIKXMFTQTD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |