C23H21F3N2O3 — CID 21294485
oxan-2-ylmethyl 2-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzoate (PubChem CID 21294485) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzoate.
| Compound Name | oxan-2-ylmethyl 2-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 21294485 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | oxan-2-ylmethyl 2-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
| SMILES | O=C(OCC1CCCCO1)c1ccccc1Nc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C23H21F3N2O3/c24-23(25,26)15-8-9-17-20(10-11-27-21(17)13-15)28-19-7-2-1-6-18(19)22(29)31-14-16-5-3-4-12-30-16/h1-2,6-11,13,16H,3-5,12,14H2,(H,27,28) |
| InChIKey | HKCQFEXGTCPZAE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |