About Diisopropoxysilane
Diisopropoxysilane (PubChem CID 21295040) has the molecular formula C6H14O2Si
and a molecular weight of 146.26 g/mol.
Molecular Properties
| Compound Name | Diisopropoxysilane |
| PubChem CID | 21295040 |
| Molecular Formula | C6H14O2Si |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | — |
| SMILES | CC(C)O[Si]OC(C)C |
| InChI | InChI=1S/C6H14O2Si/c1-5(2)7-9-8-6(3)4/h5-6H,1-4H3 |
| InChIKey | PEXCNAGVBVPDBM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diisopropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diisopropoxysilane?
The IUPAC name of Diisopropoxysilane (CID 21295040) is not available.
What is the SMILES notation for Diisopropoxysilane?
The canonical SMILES for Diisopropoxysilane is CC(C)O[Si]OC(C)C.
What is the InChIKey of Diisopropoxysilane?
The InChIKey is PEXCNAGVBVPDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2Si/c1-5(2)7-9-8-6(3)4/h5-6H,1-4H3.
What are the key properties of Diisopropoxysilane?
Diisopropoxysilane has a molecular weight of 146.26 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Diisopropoxysilane is sourced from PubChem (CID 21295040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).