C20H14ClFN4O5S — CID 21298108
N-[4-[(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 21298108) has the molecular formula C20H14ClFN4O5S and a molecular weight of 476.87 g/mol. Its IUPAC name is N-[4-[(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 21298108 |
| Molecular Formula | C20H14ClFN4O5S |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-[4-[(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | CN1C(=O)C(C(=O)Nc2ccc(Oc3nc4cc(Cl)c(F)cc4s3)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C20H14ClFN4O5S/c1-25-17(28)15(18(29)26(2)20(25)30)16(27)23-9-3-5-10(6-4-9)31-19-24-13-7-11(21)12(22)8-14(13)32-19/h3-8,15H,1-2H3,(H,23,27) |
| InChIKey | CGVJJSMQUWDEDO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|