C20H14Cl2N4O5S — CID 21298086
N-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)oxy]phenyl]-3,5-dimethyl-2,4,6-trioxo-1,3-diazinane-1-carboxamide (PubChem CID 21298086) has the molecular formula C20H14Cl2N4O5S and a molecular weight of 493.33 g/mol. Its IUPAC name is N-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)oxy]phenyl]-3,5-dimethyl-2,4,6-trioxo-1,3-diazinane-1-carboxamide.
| Compound Name | N-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)oxy]phenyl]-3,5-dimethyl-2,4,6-trioxo-1,3-diazinane-1-carboxamide |
|---|---|
| PubChem CID | 21298086 |
| Molecular Formula | C20H14Cl2N4O5S |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | N-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)oxy]phenyl]-3,5-dimethyl-2,4,6-trioxo-1,3-diazinane-1-carboxamide |
| SMILES | CC1C(=O)N(C)C(=O)N(C(=O)Nc2ccc(Oc3nc4ccc(Cl)c(Cl)c4s3)cc2)C1=O |
| InChI | InChI=1S/C20H14Cl2N4O5S/c1-9-16(27)25(2)20(30)26(17(9)28)18(29)23-10-3-5-11(6-4-10)31-19-24-13-8-7-12(21)14(22)15(13)32-19/h3-9H,1-2H3,(H,23,29) |
| InChIKey | KJDGEASMLFULTQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|