C14H14ClN5O5 — CID 134147310
1-(4-chlorophenyl)-3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]urea (PubChem CID 134147310) has the molecular formula C14H14ClN5O5 and a molecular weight of 367.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 134147310 |
| Molecular Formula | C14H14ClN5O5 |
| Molecular Weight | 367.75 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]urea |
| SMILES | CN1C(=O)C(C(=O)NNC(=O)Nc2ccc(Cl)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H14ClN5O5/c1-19-11(22)9(12(23)20(2)14(19)25)10(21)17-18-13(24)16-8-5-3-7(15)4-6-8/h3-6,9H,1-2H3,(H,17,21)(H2,16,18,24) |
| InChIKey | GHJRVNWTNZTDPL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.75 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|