C14H12ClN3O5 — CID 3309712
1-(4-chlorophenyl)-3-[(3,4,5-trihydroxybenzoyl)amino]urea (PubChem CID 3309712) has the molecular formula C14H12ClN3O5 and a molecular weight of 337.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3,4,5-trihydroxybenzoyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3,4,5-trihydroxybenzoyl)amino]urea |
|---|---|
| PubChem CID | 3309712 |
| Molecular Formula | C14H12ClN3O5 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3,4,5-trihydroxybenzoyl)amino]urea |
| SMILES | O=C(NNC(=O)c1cc(O)c(O)c(O)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN3O5/c15-8-1-3-9(4-2-8)16-14(23)18-17-13(22)7-5-10(19)12(21)11(20)6-7/h1-6,19-21H,(H,17,22)(H2,16,18,23) |
| InChIKey | FTRGEOCNXRGBAD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|