C10H15F4N5S2 — CID 21298805
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine (PubChem CID 21298805) has the molecular formula C10H15F4N5S2 and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine |
|---|---|
| PubChem CID | 21298805 |
| Molecular Formula | C10H15F4N5S2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine |
| SMILES | NCCSCc1csc(N/C(N)=N/CC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H15F4N5S2/c11-7(12)10(13,14)5-17-8(16)19-9-18-6(4-21-9)3-20-2-1-15/h4,7H,1-3,5,15H2,(H3,16,17,18,19) |
| InChIKey | PRQXEAOYRQKQLI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|