C13H28N2O4+2 — CID 21299630
acetyl-[1,1-dihydroxy-2-methyl-5-oxo-5-(trimethylazaniumyl)pentan-2-yl]-dimethylazanium (PubChem CID 21299630) has the molecular formula C13H28N2O4+2 and a molecular weight of 276.38 g/mol. Its IUPAC name is acetyl-[1,1-dihydroxy-2-methyl-5-oxo-5-(trimethylazaniumyl)pentan-2-yl]-dimethylazanium.
| Compound Name | acetyl-[1,1-dihydroxy-2-methyl-5-oxo-5-(trimethylazaniumyl)pentan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 21299630 |
| Molecular Formula | C13H28N2O4+2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | acetyl-[1,1-dihydroxy-2-methyl-5-oxo-5-(trimethylazaniumyl)pentan-2-yl]-dimethylazanium |
| SMILES | CC(=O)[N+](C)(C)C(C)(CCC(=O)[N+](C)(C)C)C(O)O |
| InChI | InChI=1S/C13H28N2O4/c1-10(16)15(6,7)13(2,12(18)19)9-8-11(17)14(3,4)5/h12,18-19H,8-9H2,1-7H3/q+2 |
| InChIKey | LSYGPXLSLJIPRA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|