C23H15N3O6 — CID 2129971
[(S)-isoquinolin-1-yl(phenyl)methyl] 3,5-dinitrobenzoate (PubChem CID 2129971) has the molecular formula C23H15N3O6 and a molecular weight of 429.39 g/mol. Its IUPAC name is [(S)-isoquinolin-1-yl(phenyl)methyl] 3,5-dinitrobenzoate.
| Compound Name | [(S)-isoquinolin-1-yl(phenyl)methyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 2129971 |
| Molecular Formula | C23H15N3O6 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [(S)-isoquinolin-1-yl(phenyl)methyl] 3,5-dinitrobenzoate |
| SMILES | O=C(O[C@@H](c1ccccc1)c1nccc2ccccc12)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15N3O6/c27-23(17-12-18(25(28)29)14-19(13-17)26(30)31)32-22(16-7-2-1-3-8-16)21-20-9-5-4-6-15(20)10-11-24-21/h1-14,22H/t22-/m0/s1 |
| InChIKey | BJENLVAGPSSPAG-QFIPXVFZSA-N |
| XLogP | 5.00 |
| TPSA | 125.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|