C28H25Cl2N2O3+ — CID 21303889
3,6-dichloro-2-(7,17-diethyl-2-oxa-17-aza-7-azoniapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),3,7,9,11,14,16(20)-heptaen-12-yl)benzoic acid (PubChem CID 21303889) has the molecular formula C28H25Cl2N2O3+ and a molecular weight of 508.43 g/mol. Its IUPAC name is 3,6-dichloro-2-(7,17-diethyl-2-oxa-17-aza-7-azoniapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),3,7,9,11,14,16(20)-heptaen-12-yl)benzoic acid.
| Compound Name | 3,6-dichloro-2-(7,17-diethyl-2-oxa-17-aza-7-azoniapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),3,7,9,11,14,16(20)-heptaen-12-yl)benzoic acid |
|---|---|
| PubChem CID | 21303889 |
| Molecular Formula | C28H25Cl2N2O3+ |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 3,6-dichloro-2-(7,17-diethyl-2-oxa-17-aza-7-azoniapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),3,7,9,11,14,16(20)-heptaen-12-yl)benzoic acid |
| SMILES | CCN1CCc2c1ccc1c2Oc2c3c(ccc2=C1c1c(Cl)ccc(Cl)c1C(=O)O)=[N+](CC)CC3 |
| InChI | InChI=1S/C28H24Cl2N2O3/c1-3-31-13-11-15-21(31)9-5-17-23(24-19(29)7-8-20(30)25(24)28(33)34)18-6-10-22-16(12-14-32(22)4-2)27(18)35-26(15)17/h5-10H,3-4,11-14H2,1-2H3/p+1 |
| InChIKey | XGFJPIHCEZJQFY-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|