C39H41Cl4NO3 — CID 118145807
2-[5-butyl-7-[(Z)-4,4-dimethylpent-2-en-2-yl]-6-methylidene-3-oxa-18-azapentacyclo[11.8.1.02,11.04,9.018,22]docosa-1(22),2(11),4,7,9,12-hexaen-10-yl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 118145807) has the molecular formula C39H41Cl4NO3 and a molecular weight of 713.57 g/mol. Its IUPAC name is 2-[5-butyl-7-[(Z)-4,4-dimethylpent-2-en-2-yl]-6-methylidene-3-oxa-18-azapentacyclo[11.8.1.02,11.04,9.018,22]docosa-1(22),2(11),4,7,9,12-hexaen-10-yl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[5-butyl-7-[(Z)-4,4-dimethylpent-2-en-2-yl]-6-methylidene-3-oxa-18-azapentacyclo[11.8.1.02,11.04,9.018,22]docosa-1(22),2(11),4,7,9,12-hexaen-10-yl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 118145807 |
| Molecular Formula | C39H41Cl4NO3 |
| Molecular Weight | 713.57 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 2-[5-butyl-7-[(Z)-4,4-dimethylpent-2-en-2-yl]-6-methylidene-3-oxa-18-azapentacyclo[11.8.1.02,11.04,9.018,22]docosa-1(22),2(11),4,7,9,12-hexaen-10-yl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | C=c1c(/C(C)=C\C(C)(C)C)cc2c(c1CCCC)Oc1c(cc3c4c1CCCN4CCCC3)C=2c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C39H41Cl4NO3/c1-7-8-13-23-21(3)25(20(2)19-39(4,5)6)18-27-28(29-30(38(45)46)32(41)34(43)33(42)31(29)40)26-17-22-12-9-10-15-44-16-11-14-24(35(22)44)37(26)47-36(23)27/h17-19H,3,7-16H2,1-2,4-6H3,(H,45,46)/b20-19- |
| InChIKey | XBGZLVPZOSELFK-VXPUYCOJSA-N |
| XLogP | 10.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.57 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|