C33H27NO5 — CID 118145799
2-(8-methylidene-3-oxa-22-azahexacyclo[15.8.1.02,15.04,13.05,10.022,26]hexacosa-1(26),2(15),4,6,9,11,13,16-octaen-14-yl)terephthalic acid (PubChem CID 118145799) has the molecular formula C33H27NO5 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-(8-methylidene-3-oxa-22-azahexacyclo[15.8.1.02,15.04,13.05,10.022,26]hexacosa-1(26),2(15),4,6,9,11,13,16-octaen-14-yl)terephthalic acid.
| Compound Name | 2-(8-methylidene-3-oxa-22-azahexacyclo[15.8.1.02,15.04,13.05,10.022,26]hexacosa-1(26),2(15),4,6,9,11,13,16-octaen-14-yl)terephthalic acid |
|---|---|
| PubChem CID | 118145799 |
| Molecular Formula | C33H27NO5 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 2-(8-methylidene-3-oxa-22-azahexacyclo[15.8.1.02,15.04,13.05,10.022,26]hexacosa-1(26),2(15),4,6,9,11,13,16-octaen-14-yl)terephthalic acid |
| SMILES | C=c1ccc2c3c(ccc2c1)=C(c1cc(C(=O)O)ccc1C(=O)O)c1cc2c4c(c1O3)CCCN4CCCC2 |
| InChI | InChI=1S/C33H27NO5/c1-18-7-10-22-19(15-18)8-12-24-28(26-17-21(32(35)36)9-11-23(26)33(37)38)27-16-20-5-2-3-13-34-14-4-6-25(29(20)34)31(27)39-30(22)24/h7-12,15-17H,1-6,13-14H2,(H,35,36)(H,37,38) |
| InChIKey | BRCQMJICSGLKRB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|