C32H30N2O3 — CID 123163434
CID 123163434 (PubChem CID 123163434) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol.
| Compound Name | CID 123163434 |
|---|---|
| PubChem CID | 123163434 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1C1=c2[c-]c3c4c(c2Oc2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| InChI | InChI=1S/C32H30N2O3/c35-32(36)22-10-2-1-9-21(22)27-25-17-19-7-3-13-33-15-5-11-23(28(19)33)30(25)37-31-24-12-6-16-34-14-4-8-20(29(24)34)18-26(27)31/h1-2,9-10,17H,3-8,11-16H2,(H,35,36) |
| InChIKey | IIQIKKNZLLJWNB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|