C32H30N2O5 — CID 153285004
2-[(7R,25S)-7,25-dihydroxy-3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl]benzoate (PubChem CID 153285004) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is 2-[(7R,25S)-7,25-dihydroxy-3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl]benzoate.
| Compound Name | 2-[(7R,25S)-7,25-dihydroxy-3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl]benzoate |
|---|---|
| PubChem CID | 153285004 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 2-[(7R,25S)-7,25-dihydroxy-3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl]benzoate |
| SMILES | O=C([O-])c1ccccc1C1=c2cc3c4c(c2Oc2c1cc1c5c2C[C@H](O)CN5CCC1)C[C@@H](O)C[N+]=4CCC3 |
| InChI | InChI=1S/C32H30N2O5/c35-19-13-25-28-17(5-3-9-33(28)15-19)11-23-27(21-7-1-2-8-22(21)32(37)38)24-12-18-6-4-10-34-16-20(36)14-26(29(18)34)31(24)39-30(23)25/h1-2,7-8,11-12,19-20,35-36H,3-6,9-10,13-16H2/t19-,20+ |
| InChIKey | CPGKDVUVPKCNSY-BGYRXZFFSA-N |
| XLogP | 0.43 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|