C41H37N2O3+ — CID 166491608
5-methyl-2-(23-oxa-31-aza-15-azonianonacyclo[25.7.1.111,15.02,25.05,24.07,22.010,21.031,35.019,36]hexatriaconta-1(35),2(25),3,5(24),6,8,10,15(36),19,21,26-undecaen-6-yl)benzoic acid (PubChem CID 166491608) has the molecular formula C41H37N2O3+ and a molecular weight of 605.76 g/mol. Its IUPAC name is 5-methyl-2-(23-oxa-31-aza-15-azonianonacyclo[25.7.1.111,15.02,25.05,24.07,22.010,21.031,35.019,36]hexatriaconta-1(35),2(25),3,5(24),6,8,10,15(36),19,21,26-undecaen-6-yl)benzoic acid.
| Compound Name | 5-methyl-2-(23-oxa-31-aza-15-azonianonacyclo[25.7.1.111,15.02,25.05,24.07,22.010,21.031,35.019,36]hexatriaconta-1(35),2(25),3,5(24),6,8,10,15(36),19,21,26-undecaen-6-yl)benzoic acid |
|---|---|
| PubChem CID | 166491608 |
| Molecular Formula | C41H37N2O3+ |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 5-methyl-2-(23-oxa-31-aza-15-azonianonacyclo[25.7.1.111,15.02,25.05,24.07,22.010,21.031,35.019,36]hexatriaconta-1(35),2(25),3,5(24),6,8,10,15(36),19,21,26-undecaen-6-yl)benzoic acid |
| SMILES | Cc1ccc(C2=c3ccc4c5c6c(cc4c3Oc3c2ccc2c4c7c(cc32)CCCN7CCC4)CCC[N+]=6CCC5)c(C(=O)O)c1 |
| InChI | InChI=1S/C41H36N2O3/c1-23-10-11-28(35(20-23)41(44)45)36-31-14-12-26-29-8-4-18-42-16-2-6-24(37(29)42)21-33(26)39(31)46-40-32(36)15-13-27-30-9-5-19-43-17-3-7-25(38(30)43)22-34(27)40/h10-15,20-22H,2-9,16-19H2,1H3/p+1 |
| InChIKey | PQUGTAFIDWCROK-UHFFFAOYSA-O |
| XLogP | 6.43 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|