About [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate
[2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate (PubChem CID 21304650) has the molecular formula C25H27ClO4
and a molecular weight of 426.94 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate |
| PubChem CID | 21304650 |
| Molecular Formula | C25H27ClO4 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(C)cc(-c3ccc(Cl)cc3)cc2C)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C25H27ClO4/c1-6-29-24(28)30-21-14-25(4,5)13-20(27)23(21)22-15(2)11-18(12-16(22)3)17-7-9-19(26)10-8-17/h7-12H,6,13-14H2,1-5H3 |
| InChIKey | JKKBWUPJSBSGIB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate?
The IUPAC name of [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate (CID 21304650) is [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate.
What is the SMILES notation for [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate?
The canonical SMILES for [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate is CCOC(=O)OC1=C(c2c(C)cc(-c3ccc(Cl)cc3)cc2C)C(=O)CC(C)(C)C1.
What is the InChIKey of [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate?
The InChIKey is JKKBWUPJSBSGIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27ClO4/c1-6-29-24(28)30-21-14-25(4,5)13-20(27)23(21)22-15(2)11-18(12-16(22)3)17-7-9-19(26)10-8-17/h7-12H,6,13-14H2,1-5H3.
What are the key properties of [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate?
[2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate has a molecular weight of 426.94 g/mol, XLogP of 6.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5,5-dimethyl-3-oxocyclohexen-1-yl] ethyl carbonate is sourced from PubChem (CID 21304650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).