C32H60N8O — CID 21305816
N-methyl-N'-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 21305816) has the molecular formula C32H60N8O and a molecular weight of 572.89 g/mol. Its IUPAC name is N-methyl-N'-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N-methyl-N'-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 21305816 |
| Molecular Formula | C32H60N8O |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.49 |
| IUPAC Name | N-methyl-N'-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CN(CCCCCCN(c1ncnc(N2CCOCC2)n1)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H60N8O/c1-29(2)20-25(21-30(3,4)36-29)38(9)14-12-10-11-13-15-40(26-22-31(5,6)37-32(7,8)23-26)28-34-24-33-27(35-28)39-16-18-41-19-17-39/h24-26,36-37H,10-23H2,1-9H3 |
| InChIKey | IQMRPTOEYMGQTO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|