C37H70N8O — CID 59689310
N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)octane-1,8-diamine (PubChem CID 59689310) has the molecular formula C37H70N8O and a molecular weight of 643.02 g/mol. Its IUPAC name is N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)octane-1,8-diamine.
| Compound Name | N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)octane-1,8-diamine |
|---|---|
| PubChem CID | 59689310 |
| Molecular Formula | C37H70N8O |
| Molecular Weight | 643.02 g/mol |
| Exact Mass | 642.57 |
| IUPAC Name | N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)octane-1,8-diamine |
| SMILES | Cc1nc(N2CCOCC2)nc(N(CCCCCCCCN(C)C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C37H70N8O/c1-29-38-32(44-21-23-46-24-22-44)40-33(39-29)45(31-27-36(6,7)43(12)37(8,9)28-31)20-18-16-14-13-15-17-19-41(10)30-25-34(2,3)42(11)35(4,5)26-30/h30-31H,13-28H2,1-12H3 |
| InChIKey | DOSPITHQBOMIOM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.02 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|