C37H66N8O — CID 163437924
N,N'-bis(1-ethenyl-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)hexane-1,6-diamine (PubChem CID 163437924) has the molecular formula C37H66N8O and a molecular weight of 638.99 g/mol. Its IUPAC name is N,N'-bis(1-ethenyl-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(1-ethenyl-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 163437924 |
| Molecular Formula | C37H66N8O |
| Molecular Weight | 638.99 g/mol |
| Exact Mass | 638.54 |
| IUPAC Name | N,N'-bis(1-ethenyl-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)hexane-1,6-diamine |
| SMILES | C=CN1C(C)(C)CC(N(C)CCCCCCN(c2nc(C)nc(N3CCOCC3)n2)C2CC(C)(C)N(C=C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C37H66N8O/c1-13-44-34(4,5)25-30(26-35(44,6)7)41(12)19-17-15-16-18-20-43(31-27-36(8,9)45(14-2)37(10,11)28-31)33-39-29(3)38-32(40-33)42-21-23-46-24-22-42/h13-14,30-31H,1-2,15-28H2,3-12H3 |
| InChIKey | AWBWYHGAOFFMMU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.99 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|