C28H39N3O11 — CID 21308802
[(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[6-aminohexanoyl(phenylmethoxycarbonyl)amino]oxan-2-yl]methyl acetate (PubChem CID 21308802) has the molecular formula C28H39N3O11 and a molecular weight of 593.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[6-aminohexanoyl(phenylmethoxycarbonyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[6-aminohexanoyl(phenylmethoxycarbonyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21308802 |
| Molecular Formula | C28H39N3O11 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[6-aminohexanoyl(phenylmethoxycarbonyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1N(C(=O)CCCCCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H39N3O11/c1-17(32)30-24-26(41-20(4)35)25(40-19(3)34)22(16-38-18(2)33)42-27(24)31(23(36)13-9-6-10-14-29)28(37)39-15-21-11-7-5-8-12-21/h5,7-8,11-12,22,24-27H,6,9-10,13-16,29H2,1-4H3,(H,30,32)/t22-,24-,25+,26-,27+/m1/s1 |
| InChIKey | LLPXSXXLGGLFOS-INFWBLCHSA-N |
| XLogP | 1.33 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|