C18H40O4 — CID 21312408
hydrogen peroxide;2-hydroperoxy-2,4,4-trimethylpentane;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 21312408) has the molecular formula C18H40O4 and a molecular weight of 320.51 g/mol. Its IUPAC name is hydrogen peroxide;2-hydroperoxy-2,4,4-trimethylpentane;1-methyl-4-propan-2-ylcyclohexane.
| Compound Name | hydrogen peroxide;2-hydroperoxy-2,4,4-trimethylpentane;1-methyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 21312408 |
| Molecular Formula | C18H40O4 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | hydrogen peroxide;2-hydroperoxy-2,4,4-trimethylpentane;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC(C)(C)CC(C)(C)OO.CC1CCC(C(C)C)CC1.OO |
| InChI | InChI=1S/C10H20.C8H18O2.H2O2/c1-8(2)10-6-4-9(3)5-7-10;1-7(2,3)6-8(4,5)10-9;1-2/h8-10H,4-7H2,1-3H3;9H,6H2,1-5H3;1-2H |
| InChIKey | ZSTWENQJYDODNO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|