C22H48O6 — CID 162196045
2-hydroperoxy-2-methylpropane;1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane;2-hydroperoxy-2,4,4-trimethylpentane (PubChem CID 162196045) has the molecular formula C22H48O6 and a molecular weight of 408.62 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane;2-hydroperoxy-2,4,4-trimethylpentane.
| Compound Name | 2-hydroperoxy-2-methylpropane;1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane;2-hydroperoxy-2,4,4-trimethylpentane |
|---|---|
| PubChem CID | 162196045 |
| Molecular Formula | C22H48O6 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane;2-hydroperoxy-2,4,4-trimethylpentane |
| SMILES | CC(C)(C)CC(C)(C)OO.CC(C)(C)OO.CC1CCC(C(C)(C)OO)CC1 |
| InChI | InChI=1S/C10H20O2.C8H18O2.C4H10O2/c1-8-4-6-9(7-5-8)10(2,3)12-11;1-7(2,3)6-8(4,5)10-9;1-4(2,3)6-5/h8-9,11H,4-7H2,1-3H3;9H,6H2,1-5H3;5H,1-3H3 |
| InChIKey | ZQYIIBLXBYKTFN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|