C11H16ClNO4S — CID 21314642
(5-tert-butyl-3-chloro-2-hydroxyphenyl)methylsulfamic acid (PubChem CID 21314642) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is (5-tert-butyl-3-chloro-2-hydroxyphenyl)methylsulfamic acid.
| Compound Name | (5-tert-butyl-3-chloro-2-hydroxyphenyl)methylsulfamic acid |
|---|---|
| PubChem CID | 21314642 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (5-tert-butyl-3-chloro-2-hydroxyphenyl)methylsulfamic acid |
| SMILES | CC(C)(C)c1cc(Cl)c(O)c(CNS(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H16ClNO4S/c1-11(2,3)8-4-7(6-13-18(15,16)17)10(14)9(12)5-8/h4-5,13-14H,6H2,1-3H3,(H,15,16,17) |
| InChIKey | VOFVGKBRACMAMA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|