C13H8F4N2S3 — CID 21314980
2-(1,1,2,2-tetrafluoroethylsulfanyl)-4,5-dithiophen-2-yl-1H-imidazole (PubChem CID 21314980) has the molecular formula C13H8F4N2S3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrafluoroethylsulfanyl)-4,5-dithiophen-2-yl-1H-imidazole.
| Compound Name | 2-(1,1,2,2-tetrafluoroethylsulfanyl)-4,5-dithiophen-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 21314980 |
| Molecular Formula | C13H8F4N2S3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 2-(1,1,2,2-tetrafluoroethylsulfanyl)-4,5-dithiophen-2-yl-1H-imidazole |
| SMILES | FC(F)C(F)(F)Sc1nc(-c2cccs2)c(-c2cccs2)[nH]1 |
| InChI | InChI=1S/C13H8F4N2S3/c14-11(15)13(16,17)22-12-18-9(7-3-1-5-20-7)10(19-12)8-4-2-6-21-8/h1-6,11H,(H,18,19) |
| InChIKey | BGVHBGKDAUAZMR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|