C20H16N2S2 — CID 950258
2-(4-methylsulfanylphenyl)-4-phenyl-5-thiophen-2-yl-1H-imidazole (PubChem CID 950258) has the molecular formula C20H16N2S2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-4-phenyl-5-thiophen-2-yl-1H-imidazole.
| Compound Name | 2-(4-methylsulfanylphenyl)-4-phenyl-5-thiophen-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 950258 |
| Molecular Formula | C20H16N2S2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-4-phenyl-5-thiophen-2-yl-1H-imidazole |
| SMILES | CSc1ccc(-c2nc(-c3ccccc3)c(-c3cccs3)[nH]2)cc1 |
| InChI | InChI=1S/C20H16N2S2/c1-23-16-11-9-15(10-12-16)20-21-18(14-6-3-2-4-7-14)19(22-20)17-8-5-13-24-17/h2-13H,1H3,(H,21,22) |
| InChIKey | CJUQLYNFKFDTFY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |