C9H15N3O2 — CID 21315312
N-butyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide (PubChem CID 21315312) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-butyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide.
| Compound Name | N-butyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 21315312 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-butyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
| SMILES | CCCCN(C(C)=O)c1nnc(C)o1 |
| InChI | InChI=1S/C9H15N3O2/c1-4-5-6-12(8(3)13)9-11-10-7(2)14-9/h4-6H2,1-3H3 |
| InChIKey | RSPCNWLJNUGGEE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |