C13H22N2O2 — CID 12556890
(2S)-N-butyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide (PubChem CID 12556890) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S)-N-butyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide.
| Compound Name | (2S)-N-butyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide |
|---|---|
| PubChem CID | 12556890 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (2S)-N-butyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide |
| SMILES | CCCCN(C(=O)[C@@H](C)CC)c1nc(C)co1 |
| InChI | InChI=1S/C13H22N2O2/c1-5-7-8-15(12(16)10(3)6-2)13-14-11(4)9-17-13/h9-10H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | XSBXJNYUXNMUOK-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |