C15H26N2O2 — CID 12556915
N-butyl-N-(4-butyl-1,3-oxazol-2-yl)-2-methylpropanamide (PubChem CID 12556915) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N-butyl-N-(4-butyl-1,3-oxazol-2-yl)-2-methylpropanamide.
| Compound Name | N-butyl-N-(4-butyl-1,3-oxazol-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 12556915 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-butyl-N-(4-butyl-1,3-oxazol-2-yl)-2-methylpropanamide |
| SMILES | CCCCc1coc(N(CCCC)C(=O)C(C)C)n1 |
| InChI | InChI=1S/C15H26N2O2/c1-5-7-9-13-11-19-15(16-13)17(10-8-6-2)14(18)12(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | FTCQJTYMXBTFJS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |