C15H27N3O2 — CID 23468965
1-butyl-3-hexyl-1-(4-methyl-1,3-oxazol-2-yl)urea (PubChem CID 23468965) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-butyl-3-hexyl-1-(4-methyl-1,3-oxazol-2-yl)urea.
| Compound Name | 1-butyl-3-hexyl-1-(4-methyl-1,3-oxazol-2-yl)urea |
|---|---|
| PubChem CID | 23468965 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-butyl-3-hexyl-1-(4-methyl-1,3-oxazol-2-yl)urea |
| SMILES | CCCCCCNC(=O)N(CCCC)c1nc(C)co1 |
| InChI | InChI=1S/C15H27N3O2/c1-4-6-8-9-10-16-14(19)18(11-7-5-2)15-17-13(3)12-20-15/h12H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | QVHXBSBPDZGHIQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|