About ethylphenyl-silanol
ethylphenyl-silanol (PubChem CID 21326962) has the molecular formula C8H11OSi
and a molecular weight of 151.26 g/mol.
Molecular Properties
| Compound Name | ethylphenyl-silanol |
| PubChem CID | 21326962 |
| Molecular Formula | C8H11OSi |
| Molecular Weight | 151.26 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | — |
| SMILES | CC[Si](O)c1ccccc1 |
| InChI | InChI=1S/C8H11OSi/c1-2-10(9)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3 |
| InChIKey | WXONNLHTUDAISX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethylphenyl-silanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylphenyl-silanol?
The IUPAC name of ethylphenyl-silanol (CID 21326962) is not available.
What is the SMILES notation for ethylphenyl-silanol?
The canonical SMILES for ethylphenyl-silanol is CC[Si](O)c1ccccc1.
What is the InChIKey of ethylphenyl-silanol?
The InChIKey is WXONNLHTUDAISX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11OSi/c1-2-10(9)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3.
What are the key properties of ethylphenyl-silanol?
ethylphenyl-silanol has a molecular weight of 151.26 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylphenyl-silanol is sourced from PubChem (CID 21326962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).