C20H29NO5 — CID 21334798
[1-(ethylamino)-1-oxooctan-2-yl] 4-[(E)-3,3-dihydroxyprop-1-enyl]benzoate (PubChem CID 21334798) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is [1-(ethylamino)-1-oxooctan-2-yl] 4-[(E)-3,3-dihydroxyprop-1-enyl]benzoate.
| Compound Name | [1-(ethylamino)-1-oxooctan-2-yl] 4-[(E)-3,3-dihydroxyprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 21334798 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [1-(ethylamino)-1-oxooctan-2-yl] 4-[(E)-3,3-dihydroxyprop-1-enyl]benzoate |
| SMILES | CCCCCCC(OC(=O)c1ccc(/C=C/C(O)O)cc1)C(=O)NCC |
| InChI | InChI=1S/C20H29NO5/c1-3-5-6-7-8-17(19(24)21-4-2)26-20(25)16-12-9-15(10-13-16)11-14-18(22)23/h9-14,17-18,22-23H,3-8H2,1-2H3,(H,21,24)/b14-11+ |
| InChIKey | AYXQRTUNIMTCCF-SDNWHVSQSA-N |
| XLogP | 2.64 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|