C11H12O8 — CID 21335620
5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid (PubChem CID 21335620) has the molecular formula C11H12O8 and a molecular weight of 272.21 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid.
| Compound Name | 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 21335620 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid |
| SMILES | C=C(C)C(=O)C1OC(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C11H12O8/c1-3(2)6(12)7-4(9(13)14)5(10(15)16)8(19-7)11(17)18/h4-5,7-8H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | XJEDYSXWBRWEMH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|