5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid

C11H12O8 — CID 21335620

IUPAC5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid
SMILESC=C(C)C(=O)C1OC(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C11H12O8/c1-3(2)6(12)7-4(9(13)14)5(10(15)16)8(19-7)11(17)18/h4-5,7-8H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18)
InChIKeyXJEDYSXWBRWEMH-UHFFFAOYSA-N
MW272.21 g/mol
LogP-0.61
Rot. Bonds5

About 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid

5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid (PubChem CID 21335620) has the molecular formula C11H12O8 and a molecular weight of 272.21 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid.

Molecular Properties

Compound Name5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid
PubChem CID21335620
Molecular FormulaC11H12O8
Molecular Weight272.21 g/mol
Exact Mass272.05
IUPAC Name5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid
SMILESC=C(C)C(=O)C1OC(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C11H12O8/c1-3(2)6(12)7-4(9(13)14)5(10(15)16)8(19-7)11(17)18/h4-5,7-8H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18)
InChIKeyXJEDYSXWBRWEMH-UHFFFAOYSA-N
XLogP-0.61
TPSA138.20 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.21
LogP ≤ 5-0.61
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid?
The IUPAC name of 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid (CID 21335620) is 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid.
What is the SMILES notation for 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid?
The canonical SMILES for 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid is C=C(C)C(=O)C1OC(C(=O)O)C(C(=O)O)C1C(=O)O.
What is the InChIKey of 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid?
The InChIKey is XJEDYSXWBRWEMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O8/c1-3(2)6(12)7-4(9(13)14)5(10(15)16)8(19-7)11(17)18/h4-5,7-8H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18).
What are the key properties of 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid?
5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid has a molecular weight of 272.21 g/mol, XLogP of -0.61, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylprop-2-enoyl)oxolane-2,3,4-tricarboxylic acid is sourced from PubChem (CID 21335620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).