C19H30N2O4S — CID 21336994
N-[2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]ethyl]-2-methyl-2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]propanamide (PubChem CID 21336994) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]ethyl]-2-methyl-2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]propanamide.
| Compound Name | N-[2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]ethyl]-2-methyl-2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]propanamide |
|---|---|
| PubChem CID | 21336994 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]ethyl]-2-methyl-2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]propanamide |
| SMILES | C=C(C)COc1ccc(CCNC(=O)C(C)(C)NS(=C)(C)=O)cc1OC |
| InChI | InChI=1S/C19H30N2O4S/c1-14(2)13-25-16-9-8-15(12-17(16)24-5)10-11-20-18(22)19(3,4)21-26(6,7)23/h8-9,12H,1,6,10-11,13H2,2-5,7H3,(H,20,22)(H,21,23) |
| InChIKey | LJXCAPNTGNPTQX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|